heptyl nonanoate


heptyl nonanoate; nonanoic acid, heptyl ester
Links:📏 NIST, 🕷 ChemSpider
CAS RN:[71605-85-1]
Formula:C16H32O2; 256.43 g/mol
InChiKey:ARSLOAKOWGOSEX-UHFFFAOYSA-N
SMILES:CCCCCCCCC(=O)OCCCCCCC
Molecular structure of heptyl nonanoate
Melting point:-16 °C

Isomers

butyl dodecanoate
Molecular structure of butyl dodecanoate
ethyl tetradecanoate
Molecular structure of ethyl tetradecanoate
heptyl nonanoate
Molecular structure of heptyl nonanoate
hexadecanoic acid
Molecular structure of hexadecanoic acid
2-hexyldecanoic acid
Molecular structure of 2-hexyldecanoic acid
isobutyl dodecanoate
Molecular structure of isobutyl dodecanoate
methyl pentadecanoate
Molecular structure of methyl pentadecanoate
octyl octanoate
Molecular structure of octyl octanoate
tetradecyl acetate
Molecular structure of tetradecyl acetate